Editing Benzphetamine (section)

{{Short description|Chemical compound}}
{{Global|date=March 2025}}
{{Use dmy dates|date=September 2024}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{drugbox
| Verifiedfields = verified
| verifiedrevid = 459955085
| INN = Benzfetamine
| image = Benzphetamine.svg
| width = 250px
| alt = 
| image2 = Benzphetamine-MV.png
| width2 = 225px
| alt2 = <!-- Clinical data -->
| pronounce = 
| tradename = Didrex, Recede
| Drugs.com = {{drugs.com|ppa|benzphetamine}}
| MedlinePlus = 
| DailyMedID = Benzphetamine
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment = 
| pregnancy_category = 
| dependency_liability = High<ref>{{cite web|url= http://toxnet.nlm.nih.gov/cgi-bin/sis/search/a?dbs+hsdb:@term+@DOCNO+3294|title= Benzphetamine|author= <!--Staff writer(s); no by-line.-->|website= Toxnet|archive-url= https://web.archive.org/web/20181101101226/https://toxnet.nlm.nih.gov/cgi-bin/sis/search/a?dbs+hsdb:@term+@DOCNO+3294|archive-date= 2018-11-01|url-status= dead}}</ref>
| addiction_liability = 
| routes_of_administration = [[Oral administration|By mouth]]
| class = 
| ATC_prefix = None
| ATC_suffix = 
| ATC_supplemental = <!-- Legal status -->
| legal_AU = S4
| legal_AU_comment = 
| legal_BR = F2
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-07-25}}</ref>
| legal_CA = Schedule I
| legal_DE = Anlage I
| legal_US = Schedule III
| legal_UK = Class C
| legal_EU = 
| legal_EU_comment = 
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment = 
| legal_status = <!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 75–99%
| metabolism = 
| metabolites = • [[Dextromethamphetamine]]<br />• [[Dextroamphetamine]]
| onset = 
| elimination_half-life = 4–6 hours<ref name="Woo2015" />
| duration_of_action = 
| excretion = <!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 156-08-1
| CAS_supplemental = 
| PubChem = 5311017
| IUPHAR_ligand = 
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00865
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4470556
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0M3S43XK27
| KEGG = D07514
| KEGG2 = D07515
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3044
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 3545985
| NIAID_ChemDB = 
| PDB_ligand = 
| synonyms = Benzfetamine; ''d''-Benzphetamine; (+)-Benzphetamine; (''S'')-(+)-Benzphetamine; (''S'')-Benzphetamine; (2''S'')-''N''-Benzyl-''N''-methylamphetamine; ''dextro''-''N''-Benzyl-''N''-methylamphetamine; ''N''-Benzyldextromethamphetamine; (+)-''N''-Benzyl-''N'',α-dimethylphenethylamine

<!-- Chemical data -->| IUPAC_name = (2''S'')-''N''-Benzyl-''N''-methyl-1-phenylpropan-2-amine
| C = 17
| H = 21
| N = 1
| SMILES = N(C)(Cc1ccccc1)[C@@H](C)Cc2ccccc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H21N/c1-15(13-16-9-5-3-6-10-16)18(2)14-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3/t15-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YXKTVDFXDRQTKV-HNNXBMFYSA-N
}}

'''Benzphetamine''', sold under the brand name '''Didrex''' among others, is an [[amphetamine-type stimulant]] and [[anorectic|appetite suppressant]] used short-term for [[weight loss]] along with a doctor-approved, reduced-[[calorie]] [[dieting|diet]], [[exercise]], and behavioral program. It is prescribed for [[obesity]] to people who have been unable to lose weight through exercise and dieting alone. It is a [[prodrug]] of [[dextromethamphetamine]] and [[dextroamphetamine]].<ref name="LLC2014">{{cite book|author=AHC Media, LLC|title=Pediatric Trauma Care II: A clinical reference for physicians and nurses caring for the acutely injured child|url=https://books.google.com/books?id=9fucAwAAQBAJ&pg=PA118|date=17 March 2014|publisher=AHC Media, LLC|isbn=978-1-934863-59-6|pages=118–}}</ref><ref>{{cite journal | vauthors = Cody JT, Valtier S | title = Detection of amphetamine and methamphetamine following administration of benzphetamine | journal = Journal of Analytical Toxicology | volume = 22 | issue = 4 | pages = 299–309 | year = 1998 | pmid = 9681333 | doi = 10.1093/jat/22.4.299 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Budd RD, Jain NC | doi = 10.1093/jat/2.6.241| title = Short Communication: Metabolism and Excretion of Benzphetamine: Sources of Error in Reporting Results| journal = Journal of Analytical Toxicology| volume = 2| issue = 6| pages = 241| year = 1978 }}</ref>