Editing Cabergoline (section)

{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{More medical citations needed|date=August 2023}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477165198
| IUPAC_name = (6a''R'',9''R'',10a''R'')-''N''-[3-(dimethylamino)propyl]-''N''-(ethylcarbamoyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4''H''-indolo[4,3-fg]quinoline-9-carboxamide
| image = Cabergoline.svg
| image_class = skin-invert-image
| width = <!--Clinical data-->
| image2 = Cabergoline.png
| width2 = 
| tradename = Dostinex, others
| Drugs.com = {{drugs.com|monograph|cabergoline}}
| DailyMedID = Cabergoline
| routes_of_administration = [[Oral administration|By mouth]]
| ATC_prefix = G02
| ATC_suffix = CB03
| ATC_supplemental = {{ATC|N04|BC06}}

<!-- Legal status -->| legal_AU = S4
| legal_AU_comment = <ref>{{cite web | title=Carbelin (Nova Pharmaceuticals Australasia Pty Ltd) | website=Therapeutic Goods Administration (TGA) | date=13 September 2024 | url=https://www.tga.gov.au/resources/prescription-medicines-registrations/carbelin-nova-pharmaceuticals-australasia-pty-ltd | access-date=15 September 2024}}</ref>
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment = 
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment = 
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment = 
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment = 
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment = 
| legal_US = Rx-only
| legal_US_comment = 
| legal_EU = 
| legal_EU_comment = 
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment = 
| legal_status = <!-- For countries not listed above -->

<!--Pharmacokinetic data-->| bioavailability = 50 - 80% <ref>https://nsj.org.sa/content/nsj/7/4/221.full.pdf {{Bare URL PDF|date=May 2025}}</ref>
| protein_bound = Moderately bound (40–42%); concentration-independent
| metabolism = [[Liver]], predominately via hydrolysis of the [[acylurea]] bond or the urea moiety
| elimination_half-life = 63–69 hours (estimated)
| excretion = Urine (22%), feces (60%)

<!--Identifiers-->| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 81409-90-7
| PubChem = 54746
| IUPHAR_ligand = 37
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00248
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 49452
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = LL60K9J05T
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00987
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3286
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201087
| synonyms = <!--Chemical data-->
| C = 26
| H = 37
| N = 5
| O = 2
| SMILES = [H][C@]12C[C@@H](C(=O)N(CCCN(C)C)C(=O)NCC)CN(CC=C)[C@]1([H])Cc3c[nH]c4cccc2c34
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C26H37N5O2/c1-5-11-30-17-19(25(32)31(26(33)27-6-2)13-8-12-29(3)4)14-21-20-9-7-10-22-24(20)18(16-28-22)15-23(21)30/h5,7,9-10,16,19,21,23,28H,1,6,8,11-15,17H2,2-4H3,(H,27,33)/t19-,21-,23-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KORNTPPJEAJQIU-KJXAQDMKSA-N
}}

'''Cabergoline''', sold under the brand name '''Dostinex''' among others, is a [[dopaminergic]] medication used in the treatment of [[hyperprolactinemia|high prolactin levels]], [[prolactinoma]]s, [[Parkinson's disease]], and for other indications.<ref>{{Cite web |title=Cabergoline: MedlinePlus Drug Information |url=https://medlineplus.gov/druginfo/meds/a612020.html |access-date=2023-10-22 |website=medlineplus.gov |language=en}}</ref> It is taken [[oral administration|by mouth]].

Cabergoline is an [[ergot]] derivative and a potent [[dopamine]] [[D2 receptor|D<sub>2</sub> receptor]] [[agonist]].<ref>{{cite book| vauthors = Elks J, Ganellin CR |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|date=1990|publisher=Springer|pages=204–}}</ref>

<!-- Society and culture -->
Cabergoline was [[patent]]ed in 1980 and approved for medical use in 1993.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=533 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA533 }}</ref> It is on the [[WHO Model List of Essential Medicines|World Health Organization's List of Essential Medicines]].<ref name="WHO23rd">{{cite book | vauthors = ((World Health Organization)) | title = The selection and use of essential medicines 2023: web annex A: World Health Organization model list of essential medicines: 23rd list (2023) | year = 2023 | hdl = 10665/371090 | author-link = World Health Organization | publisher = World Health Organization | location = Geneva | id = WHO/MHP/HPS/EML/2023.02 | hdl-access=free }}</ref>