Editing Chromate and dichromate (section)

{{Short description|Chromium(VI) anions}}
{{About|the salts of the chromium(VI) anion||Chromate (disambiguation){{!}}Chromate|text=See also for disambiguation of derived terms.}}
{{Distinguish|chromite (compound)|monochromat|dichromat|trichromat|tetrachromat}}
{{Chembox
| ImageFileL1 = Chromate-2D-dimensions.png
| ImageClassL1 = skin-invert-image
| ImageAltL1 =
| ImageSizeL1 = 75px
| ImageFileR1 = Dichromate-2D-dimensions.png
| ImageClassR1 = skin-invert-image
| ImageAltR1 = The structure and bonding of the dichromate ion
| ImageSizeR1 = 150px
| ImageFileL2 = Chromate-3D-balls.png
| ImageClassL2 = bg-transparent
| ImageAltL2 = [[Ball-and-stick model]] of the chromate anion
| ImageSizeL2 = 75px
| ImageFileR2 = Dichromate-3D-balls.png
| ImageClassR2 = bg-transparent
| ImageAltR2 = Space-filling model of the dichromate anion
| ImageSizeR2 = 150px
| SystematicName = Chromate and dichromate
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| index_label = chromate
| index1_label = dichromate
| CASNo = 13907-45-4
| CASNo_Ref = {{Cascite|changed|CAS}}
| CASNo1 = 13907-47-6
| CASNo1_Ref = {{Cascite|changed|CAS}}
| ChEBI = 35404
| ChEBI1 = 33141
| ChemSpiderID = 22869
| ChemSpiderID1 = 22911
| DrugBank1 = DB14182
| DTXSID = DTXSID7065675
| DTXSID1 = DTXSID5074004
| PubChem = 24461
| PubChem1 = 24503
| UNII = 9S2Y101D6M
| UNII1 = 9LKY4BFN2V
| InChI=1S/Cr.4O/q;;;2*-1
| InChIKey=ZCDOYSPFYFSLEW-UHFFFAOYSA-N
| InChI1=1S/2Cr.7O/q;;;;;;;2*-1
| InChIKey1=SOCTUWSJJQCPFX-UHFFFAOYSA-N
| SMILES1 = O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-]
| SMILES = [O-][Cr](=O)(=O)[O-]
 }}
| Section2 = {{Chembox Properties
| Formula = {{chem2|CrO4(2-)}} and {{chem2|Cr2O7(2-)}}
| MolarMass = 115.994 g mol<sup>−1</sup> and 215.988 g mol<sup>−1</sup>
| Appearance =
| Solubility = 
| ConjugateAcid = [[Chromic acid]]}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}

'''Chromate''' salts contain the chromate anion, {{chem2|CrO4(2-)}}. '''Dichromate''' salts contain the dichromate anion, {{chem2|Cr2O7(2-)}}. They are [[oxyanion]]s of [[chromium]] in the +6 [[oxidation state]] and are moderately strong [[oxidizing agent]]s. In an [[aqueous]] [[Solution (chemistry)|solution]], chromate and dichromate ions can be interconvertible.