Editing Cobalt(II) chloride (section)

{{Redirect|CoCl2|the compound with molecular formula {{chem2|COCl2}}|Phosgene}}
{{chembox
| Verifiedfields = changed
| Watchedfields  = changed
| verifiedrevid  = 476995997
| Name           = Cobalt(II) chloride
| ImageFile    = Cobaltous chloride.jpg
| ImageCaption = Hexahydrate
| ImageFile1    = Cobaltous chloride anhydrous.jpg
| ImageCaption1 = Anhydrous
| IUPACName      = Cobalt(II) chloride
| OtherNames     = Cobaltous chloride<br />Cobalt dichloride<br>Muriate of cobalt<ref>{{cite web|url=http://www.chemindustry.com/chemicals/0519906.html.|title=Cobalt muriate, CAS Number: 7646-79-9|website=www.chemindustry.com|access-date=19 April 2018|archive-date=28 May 2019|archive-url=https://web.archive.org/web/20190528032158/http://www.chemindustry.com/chemicals/0519906.html.|url-status=dead}}</ref>
| Section1       = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22708
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = EVS87XF13W
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = 17AVG63ZBC
| UNII1_Comment = (hexahydrate)
| InChI = 1/2ClH.Co/h2*1H;/q;;+2/p-2
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 35696
| SMILES = Cl[Co]Cl
| SMILES_Comment = anhydrous
| SMILES1 = Cl[Co-4](Cl)([OH2+])([OH2+])([OH2+])[OH2+].O.O
| SMILES1_Comment = hexahydrate
| InChIKey = GVPFVAHMJGGAJG-NUQVWONBAU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2ClH.Co/h2*1H;/q;;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GVPFVAHMJGGAJG-UHFFFAOYSA-L
| CASNo = 7646-79-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo2_Ref = {{cascite|changed|CAS}}
| CASNo2 = 16544-92-6
| CASNo2_Comment = (dihydrate)
| CASNo3_Ref = {{cascite|correct|CAS}}
| CASNo3 = 7791-13-1
| CASNo3_Comment = (hexahydrate)
| PubChem = 3032536
| RTECS = GF9800000
| UNNumber = 3288
| EINECS = 231-589-4
 }}
| Section2       = {{Chembox Properties
| Formula = CoCl<sub>2</sub>
| MolarMass = 129.839 g/mol (anhydrous) <br> 165.87 g/mol (dihydrate) <br />237.93 g/mol (hexahydrate)
| Appearance = blue crystals (anhydrous) <br> violet-blue (dihydrate) <br>  rose red crystals (hexahydrate)
| Density = 3.356 g/cm<sup>3</sup> (anhydrous) <br> 2.477 g/cm<sup>3</sup> (dihydrate) <br> 1.924 g/cm<sup>3</sup> (hexahydrate)
| Solubility = 43.6 g/100 mL (0 °C) <br> 45 g/100 mL (7 °C)<br />52.9 g/100 mL (20 °C) <br> 105 g/100 mL (96 °C) 
| SolubleOther = 38.5 g/100 mL (methanol) <br> 8.6 g/100 mL (acetone) <br> soluble in [[ethanol]], [[pyridine]], [[glycerol]]
| MeltingPtC = 726
| MeltingPt_notes = ±2 (anhydrous)<ref name=wojak/> <br> 140 °C (monohydrate) <br> 100 °C (dihydrate) <br> 86 °C (hexahydrate)
| BoilingPtC = 1049
| MagSus = +12,660·10<sup>−6</sup> cm<sup>3</sup>/mol
 }}
| Section3       = {{Chembox Structure
| Coordination = hexagonal (anhydrous) <br> monoclinic (dihydrate) <br> [[Octahedron|Octahedral]] (hexahydrate)
| CrystalStruct = [[Cadmium chloride#Structure|CdCl<sub>2</sub> structure]]
 }}
| Section7       = {{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics0783.htm ICSC 0783]
| GHSPictograms = {{GHS06}} {{GHS08}} {{GHS09}}
| GHSSignalWord =
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 0
| NFPA-S =
| NFPA_ref = <ref>[http://datasheets.scbt.com/sc-252623.pdf Santa Cruz Biotechnology: Cobalt(II) chloride]</ref>
| FlashPt = Non-flammable
| LD50 = 80 mg/kg (rat, oral)
 }}
| Section8       = {{Chembox Related
| OtherAnions = [[Cobalt(II) fluoride]]<br />[[Cobalt(II) bromide]]<br />[[Cobalt(II) iodide]]
| OtherCations = [[Rhodium(III) chloride]]<br />[[Iridium(III) chloride]]
}}
}}

'''Cobalt(II) chloride''' is an [[inorganic compound]], a salt of [[cobalt]] and [[chlorine]], with the formula {{chem|CoCl|2}}. The compound forms several [[hydrate]]s {{chem|CoCl|2}}·''n''{{chem|H|2|O}}, for ''n'' = 1, 2, 6, and 9. Claims of the formation of tri- and tetrahydrates have not been confirmed.<ref name=saugier>M. T. Saugier, M. Noailly, R. Cohen-Adad, F. Paulik, and J. Paulik (1977): "Equilibres solide ⇄ liquide ⇆ vapeur du systeme binaire {{chem|CoCl|2}}-{{chem|H|2|O}}" ''Journal of Thermal Analysis'', volume 11, issue 1, pages 87–100. {{doi|10.1007/BF02104087}} Note: the lowest point of fig.6 is inconsistent with fig.7; probably should be at -27.8 C instead of 0 C.</ref> The anhydrous form is a blue crystalline solid; the dihydrate is purple and the hexahydrate is pink. Commercial samples are usually the hexahydrate, which is one of the most commonly used cobalt salts in the lab.<ref name=g&e>{{Greenwood&Earnshaw2nd}}</ref>