Editing Copper(II) nitrate (section)

{{Distinguish|Copper(I) nitrate}}
{{chembox
| Verifiedfields = changed
| Watchedfields  = changed
| verifiedrevid  = 476996432
| Name           = Copper(II) nitrate
| ImageFile1     = Copper(II)-nitrate-trihydrate-sample.jpg
| ImageFileL2    = Anhydrous-copper(II)-nitrate-unit-cell-3D-bs-17.png
| ImageFileR2    = Beta-copper(II)-nitrate-unit-cell-3D-bs-17.png
| ImageCaptionL2 = alpha polymorph<ref name="Wallwork&Addison" />
| ImageCaptionR2 = beta polymorph<ref name="Troyanov" />
| IUPACName      = Copper(II) nitrate
| OtherNames     = Cupric nitrate
| Section1       = {{Chembox Identifiers
|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|ChemSpiderID = 17582
|UNII_Ref = {{fdacite|correct|FDA}}
|UNII = 9TC879S2ZV
|UNII1_Ref = {{fdacite|correct|FDA}}
|UNII1 = 066PG1506T
|UNII1_Comment = (trihydrate)
|UNII2_Ref = {{fdacite|correct|FDA}}
|UNII2 = 0HP2H86BS6
|UNII2_Comment = (hexahydrate)
|InChI = 1/Cu.2NO3/c;2*2-1(3)4/q+2;2*-1
|SMILES = [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O
|InChIKey = XTVVROIMIGLXTD-UHFFFAOYAG
|PubChem = 18616
|PubChem1 =  9837674
|PubChem1_Comment = (trihydrate)
|PubChem2 = 9839123
|PubChem2_Comment = (hexahydrate)
|StdInChI_Ref = {{stdinchicite|correct|chemspider}}
|StdInChI = 1S/Cu.2NO3/c;2*2-1(3)4/q+2;2*-1
|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|StdInChIKey = XTVVROIMIGLXTD-UHFFFAOYSA-N
|CASNo = 3251-23-8
|CASNo_Ref = {{cascite|correct|CAS}}
|CASNo1_Ref = {{cascite|correct|CAS}}
|CASNo1 = 10031-43-3
|CASNo1_Comment = (trihydrate)
|CASNo2_Ref = {{cascite|correct|CAS}}
|CASNo2 = 13478-38-1
|CASNo2_Comment = (hexahydrate)
|CASNo3_Ref = {{cascite|changed|??}}
|CASNo3 = 19004-19-4 
|CASNo3_Comment = (hemipentahydrate)
|RTECS = GL7875000
|ChEBI_Ref = {{ebicite|changed|EBI}} 
|ChEBI = 78036
}}
| Section2       = {{Chembox Properties
|Formula = {{chem2|Cu(NO3)2}}
|MolarMass = 187.5558 g/mol (anhydrous) <br> 241.60 g/mol (trihydrate) <br> 232.591 g/mol (hemipentahydrate)
|Appearance = blue-green crystals (anhydrous)<br>blue crystals (hydrate)
|Density = 3.05 g/cm<sup>3</sup> (anhydrous) <br> 2.32 g/cm<sup>3</sup> (trihydrate) <br> 2.07 g/cm<sup>3</sup> (hexahydrate)
|Solubility = ''trihydrate:<ref name="Perrys' Chem Eng Handbook, 7th Ed">Perrys' Chem Eng Handbook, 7th Ed</ref>'' <br> 381 g/100 mL (40 °C) <br> 666 g/100 mL (80 °C)<br> ''hexahydrate:<ref name="Perrys' Chem Eng Handbook, 7th Ed"/>'' <br> 243.7 g/100 mL (80 °C) 
|SolubleOther = hydrates very soluble in [[ethanol]], [[ammonia]], [[water]]; insoluble in [[ethyl acetate]]
|MeltingPtC = 114
|MeltingPt_notes = (anhydrous, decomposes) <br> 114.5 °C (trihydrate) <br> 26.4 °C (hexahydrate, decomposes)
|BoilingPtC = 170
|BoilingPt_notes = (trihydrate, decomposes)
|MagSus = +1570.0·10<sup>−6</sup> cm<sup>3</sup>/mol (~3H<sub>2</sub>O)
}}
| Section3       = {{Chembox Structure
| CrystalStruct = orthorhombic (anhydrous) <br> rhombohedral (hydrates)
}}
| Section7       = {{Chembox Hazards
|ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/c5874.htm Cu(NO<sub>3</sub>)<sub>2</sub>·3H<sub>2</sub>O]
|MainHazards = Irritant, Oxidizer
|NFPA-H =1
|NFPA-F =0
|NFPA-R =3
|NFPA-S = OX
|PEL = TWA 1 mg/m<sup>3</sup> (as Cu)<ref name=PGCH>{{PGCH|0150}}</ref>
|REL = TWA 1 mg/m<sup>3</sup> (as Cu)<ref name=PGCH/>
|IDLH =  TWA 100 mg/m<sup>3</sup> (as Cu)<ref name=PGCH/>
}}
| Section8       = {{Chembox Related
|OtherAnions = [[Copper(II) sulfate]]<br/>[[Copper(II) chloride]]
|OtherCations = [[Silver nitrate]]<br/>[[Gold(III) nitrate]]
}}
}}

'''Copper(II) nitrate''' describes any member of the family of [[inorganic compound]]s with the formula [[Copper|Cu]]([[Nitrate|NO<sub>3</sub>]])<sub>2</sub>(H<sub>2</sub>O)<sub>x</sub>. The hydrates are [[hygroscopic]] blue [[solid]]s.  [[Anhydrous]] copper nitrate forms blue-green crystals and [[Sublimation (phase transition)|sublimes]] in a vacuum at 150-200 °C.<ref>{{cite book |last=Pass and Sutcliffe |title=Practical Inorganic Chemistry |year=1968 |publisher=Chapman and Hall |location=London}}</ref><ref name="G&E">{{Greenwood&Earnshaw2nd|page=1190}}</ref> Common hydrates are the hemipentahydrate and trihydrate.