Editing Curcumin (section)

{{Short description|Principal curcuminoid of turmeric}}
{{Distinguish|Curculin}}
{{Use American English|date=July 2021}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477166233
| Name = Curcumin
| pronounce ={{IPAc-en|ˈ|k|ɜːr|k|j|ʊ|m|ɪ|n}}
| ImageFile = curcumin.svg
| ImageSize =
| ImageClass = skin-invert
| ImageAlt  = Skeletal formula
| ImageCaption = Enol form
| ImageFile1 = curcuminKeto.svg
| ImageClass1 = skin-invert
| ImageSize1 =
| ImageAlt1  = Skeletal formula
| ImageCaption1 = Keto form
| ImageFile2 = Curcumin-enol-3D-balls.png
| ImageSize2 =
| ImageAlt2  = Ball-and-stick model
| ImageFile3 = Curcumin-keto-3D-balls.png
| ImageSize3 =
| ImageAlt3  = Ball-and-stick model
| PIN = (1''E'',6''E'')-1,7-Bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione
| OtherNames = {{Unbulleted list|(1''E'',6''E'')-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione|Diferuloylmethane|Curcumin I|C.I. 75300|Natural Yellow 3}}
| Section1 = {{Chembox Identifiers
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3962
| SMILES = O=C(\C=C\c1ccc(O)c(OC)c1)CC(=O)\C=C\c2cc(OC)c(O)cc2
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 839564
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 116438
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = IT942ZTH98
| KEGG = C10443
| InChI = 1/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+
| InChIKey = VFLDPWHFBUODDF-FCXRPNKRBF
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VFLDPWHFBUODDF-FCXRPNKRSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 458-37-7
| PubChem = 969516
| IUPHAR_ligand = 7000
| RTECS =
 }}
| Section2 = {{Chembox Properties
| C=21|H=20|O=6
| Appearance = Bright yellow-orange powder
| Density =
| Solubility =
| MeltingPtC = 183
| BoilingPt =
| pKa =
 }}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards =
| FlashPt =
 }}
| Section8 = {{Chembox Related
| OtherCpds =
 }}
}}

'''Curcumin''' is a bright yellow chemical produced by plants of the ''Curcuma longa'' species. It is the principal [[curcuminoid]] of [[turmeric]] (''Curcuma longa''), a member of the [[ginger]] family, [[Zingiberaceae]]. It is sold as a [[herbal supplement]], [[cosmetics]] ingredient, food flavoring, and [[food coloring]].<ref name=":0">{{Cite web |url= http://www.naturalproductsinsider.com/articles/2015/12/the-state-of-the-curcumin-market.aspx |title= The State of the Curcumin Market |vauthors= Majeed S |date= December 28, 2015 |website= Natural Products Insider |language= en-US |df= dmy |access-date= February 29, 2016 |archive-date= October 17, 2017 |archive-url= https://web.archive.org/web/20171017095015/https://www.naturalproductsinsider.com/articles/2015/12/the-state-of-the-curcumin-market.aspx }}</ref>

Chemically, curcumin is a [[polyphenol]], more particularly a [[diarylheptanoid]], belonging to the group of curcuminoids, which are [[natural phenol|phenolic]] [[pigment]]s responsible for the yellow color of turmeric.<ref name="pubchem">{{PubChem|969516}}</ref>

Laboratory and clinical research have not confirmed any medical use for curcumin. It is difficult to study because it is both unstable and poorly [[bioavailable]]. It is unlikely to produce useful leads for [[drug development]] as a [[lead compound]].<ref name=nelson/>