Editing Decaborane (section)

{{chembox
| Watchedfields  = changed
| verifiedrevid  = 429598903
| Name           = Decaborane
| ImageFile      = Decaborane(14)-from-xtal-view-1-tilt-3D-bs-17.png
| ImageClass = bg-transparent
| ImageSize      = 
| ImageName      = The three-dimensional structure of decaborane
| ImageFile1     = Decaborane.png
| OtherNames     = decaborane<br/>decaboron tetradecahydride
| Section1       = {{Chembox Identifiers
| ChemSpiderID = 21241886
| PubChem = 6328162
| SMILES = [H]1[BH]234[BH]156[BH]278[BH]39([H]4)[BH]712[BH]853[BH]645[BH]311[BH]922[BH]14([H]5)[H]2
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| InChI =1/B10H14/c11-5-1-2-3(1,5)7(2,9(3,5,11)13-7)8(2)4(1,2)6(1,5)10(4,8,12-6)14-8/h1-10H
| InChIKey = XAMMYYSPUSIWAS-UHFFFAOYAD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/B10H14/c11-5-1-2-3(1,5)7(2,9(3,5,11)13-7)8(2)4(1,2)6(1,5)10(4,8,12-6)14-8/h1-10H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XAMMYYSPUSIWAS-UHFFFAOYSA-N
| CASNo = 17702-41-9
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4O04290A2J
| EINECS = 241-711-8
  }}
| Section2       = {{Chembox Properties
| B = 10 | H = 14
| MolarMass = 122.22 g/mol
| Appearance = White crystals
| Odor = bitter, [[chocolate]]-like or burnt [[rubber]]<ref name=PGCH/>
| Solvent = other solvents
| SolubleOther = Slightly, in cold water. [http://www.inchem.org/documents/icsc/icsc/eics0712.htm]
| MeltingPtC = 97-98
| BoilingPtC = 213
| VaporPressure = 0.2 mmHg<ref name=PGCH/>
| Density = 0.94 g/cm<sup>3</sup><ref name=PGCH/>
  }}
| Section7       = {{Chembox Hazards
| AutoignitionPtC = 149
| AutoignitionPt_notes = 
| PEL = TWA 0.3 mg/m<sup>3</sup> (0.05 ppm) [skin]<ref name=PGCH>{{PGCH|0175}}</ref>
| FlashPtF = 176<ref name=PGCH/>
| IDLH = 15 mg/m<sup>3</sup><ref name=PGCH/>
| REL = TWA 0.3 mg/m<sup>3</sup> (0.05 ppm) ST 0.9 mg/m<sup>3</sup> (0.15 ppm) [skin]<ref name=PGCH/>
| MainHazards = may ignite spontaneously on exposure to air<ref name=PGCH/>
| LC50 = 276 mg/m<sup>3</sup> (rat, 4 hr)<br/>72 mg/m<sup>3</sup> (mouse, 4 hr)<br/>144 mg/m<sup>3</sup> (mouse, 4 hr)<ref>{{IDLH|17702419|Decaborane}}</ref>
| GHSPictograms = {{GHS02}}{{GHS06}}{{GHS07}}{{GHS08}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|228|301|310|316|320|330|335|336|370|372}}
| PPhrases = {{P-phrases|210|240|241|260|261|262|264|270|271|280|284|301+310|302+350|304+340|305+351+338|307+311|310|312|314|320|321|322|330|332+313|337+313|361|363|370+378|403+233|405|501}}
| NFPA-H = 3
| NFPA-F = 2
| NFPA-R = 2
| NFPA-S = W
}}
}}
'''Decaborane''', also called '''decaborane(14)''', is the [[inorganic compound]] with the [[chemical formula]] [[Boron|B]]<sub>10</sub>[[Hydrogen|H]]<sub>14</sub>.  It is classified as a [[Boranes|borane]] and more specifically a [[boron hydride cluster]]. This white crystalline compound is one of the principal boron hydride clusters, both as a reference structure and as a precursor to other boron hydrides.  It is toxic and volatile, giving off a foul odor, like that of burnt rubber or chocolate.