Editing Dextrorphan (section)

{{Short description|Psychoactive cough suppressant medication}}
{{Distinguish|Dextromethorphan|Dextrallorphan}}
{{Infobox drug
| Verifiedfields     = changed
| Watchedfields      = changed
| verifiedrevid      = 408496712
| IUPAC_name         = (+)-17-methyl-9a,13a,14a-morphinan-3-ol
| image              = Dextrorphan.svg
| image_class        = skin-invert-image
| image2             = Dextrorphane 3d.gif

<!--Clinical data-->| tradename          = 
| legal_US           = Unscheduled<ref>{{Cite web |last=Bensinger |first=Peter |date=October 1, 1976 |title=Dextrophan and Nalbuphine; Removal from Schedules |url=https://www.govinfo.gov/content/pkg/FR-1976-10-01/pdf/FR-1976-10-01.pdf |access-date=June 26, 2023 |website=[[NARA]]}}</ref>

<!--Identifiers-->| CAS_number_Ref     = {{cascite|correct|??}}
| CAS_number         = 125-73-5
| ATC_prefix         = None
| PubChem            = 5360697
| UNII_Ref           = {{fdacite|changed|FDA}}
| UNII               = 04B7QNO9WS
| ChEMBL_Ref         = {{ebicite|changed|EBI}}
| ChEMBL             = 1254766
| ChemSpiderID_Ref   = {{chemspidercite|changed|chemspider}}
| ChemSpiderID       = 10489895
| synonyms           = DXO, Dextrorphanol

<!--Chemical data-->| C                  = 17
| H                  = 23
| N                  = 1
| O                  = 1
| SMILES             = CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4c3cc(O)cc4
| StdInChI_Ref       = {{stdinchicite|changed|chemspider}}
| StdInChI           = 1S/C17H23NO/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17/h5-6,11,14,16,19H,2-4,7-10H2,1H3/t14-,16+,17+/m1/s1
| StdInChIKey_Ref    = {{stdinchicite|changed|chemspider}}
| StdInChIKey        = JAQUASYNZVUNQP-PVAVHDDUSA-N
}}

'''Dextrorphan''' ('''DXO''') is a [[psychoactive drug]] of the [[morphinan]] class which acts as an [[antitussive]] or [[cough suppressant]] and in high doses a [[dissociative drug|dissociative]] [[hallucinogen]]. It is the [[dextrorotatory]] [[enantiomer]] of [[racemorphan]]; the [[Levorotation|levorotatory]] enantiomer is [[levorphanol]]. Dextrorphan is produced by O-demethylation of [[dextromethorphan]] by [[CYP2D6]]. Dextrorphan is an [[NMDA receptor antagonist|NMDA antagonist]] and contributes to the psychoactive effects of dextromethorphan.<ref>{{cite journal | vauthors = Zawertailo LA, Kaplan HL, Busto UE, Tyndale RF, Sellers EM | title = Psychotropic effects of dextromethorphan are altered by the CYP2D6 polymorphism: a pilot study | journal = Journal of Clinical Psychopharmacology | volume = 18 | issue = 4 | pages = 332–337 | date = August 1998 | pmid = 9690700 | doi = 10.1097/00004714-199808000-00014 }}</ref>