Editing Diisopropyl ether (section)

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 419351384
| ImageFile = Diisopropyl ether.svg
| PIN = 2-[(Propan-2-yl)oxy]propane <!-- corrected; see also https://www.qmul.ac.uk/sbcs/iupac/bibliog/BBerrors.html -->
| OtherNames = Isopropyl ether<br />2-Isopropoxypropane<br />Diisopropyl oxide<br />DIPE
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 7626
| InChI = 1/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
| InChIKey = ZAFNJMIOTHYJRJ-UHFFFAOYAC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=108-20-3
| PubChem = 7914
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DO7Y998826
| EC_number = 203-560-6
| RTECS = TZ5425000
| UNNumber = 1159
| ChEMBL = 3185565
| StdInChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
| StdInChIKey = ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
| SMILES = O(C(C)C)C(C)C
}}
|Section2={{Chembox Properties
| C=6 | H=14 | O=1
| Density=0.725 g/ml
| Appearance=Colorless liquid
| Odor=Sharp, sweet, ether-like<ref name=NIOSH/>
| MeltingPtC=−60
| Solubility = 2 g/L at 20 °C
| BoilingPtC=68.5
| VaporPressure = 119 mmHg (20°C)<ref name=NIOSH/>
| MagSus = −79.4·10<sup>−6</sup> cm<sup>3</sup>/mol
  }}
|Section7={{Chembox Hazards
| NFPA-H=1
| NFPA-F=3
| NFPA-R=1
| GHSPictograms = {{GHS02}}{{GHS07}}{{GHS08}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|225|316|319|335|336|361|371|412}}
| PPhrases = {{P-phrases|201|202|210|233|240|241|242|243|260|261|264|270|271|273|280|281|303+361+353|304+340|305+351+338|308+313|309+311|312|332+313|337+313|370+378|403+233|403+235|405|501}}
| FlashPtC = −28
| AutoignitionPtC = 443
| ExploLimits=1.4&ndash;7.9%
| PEL = TWA 500 ppm (2100 mg/m<sup>3</sup>)<ref name=NIOSH>{{PGCH|0362}}</ref>
| IDLH = 1400 ppm<ref name=NIOSH/>
| REL = TWA 500 ppm (2100 mg/m<sup>3</sup>)<ref name=NIOSH/>
| LC50 = 38,138 ppm (rat)<br/>30,840 ppm (rabbit)<br/>28,486 ppm (rabbit)<ref name=IDLH>{{IDLH|108203|Isopropyl ether}}</ref>
| LD50 = 8470 mg/kg (rat, oral)<ref name=IDLH/>
| LDLo = 5000-6500 mg/kg (rabbit, oral)<ref name=IDLH/>
  }}
}}

'''Diisopropyl ether''' is a secondary [[ether]] that is used as a [[solvent]]. It is a colorless liquid that is slightly soluble in water, but miscible with organic solvents. It is used as an extractant and an [[oxygenate]] [[gasoline additive]].  It is obtained industrially as a byproduct in the production of [[isopropanol]] by [[hydration reaction|hydration]] of [[propylene]].<ref name=Ullmann>{{Ullmann|first1=Michael |last1=Sakuth|first2=Thomas |last2=Mensing|first3= Joachim|last3=Schuler|first4=Wilhelm |last4=Heitmann|first5=Günther |last5=Strehlke|first6Dieter |last6=Mayer|title=Ethers, Aliphatic|year=2010|doi=10.1002/14356007.a10_023.pub2}}</ref> Diisopropyl ether is sometimes represented by the abbreviation DIPE.