Editing Flecainide (section)

{{Short description|Antiarrhythmic medication}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 461100696
| image = Flecainide structure.svg
| image_class = skin-invert-image
| alt = Skeletal formula of flecainide
| width = 180
| chirality = [[Racemic mixture]]
| image2 = Flecainide 3D ball.png
| alt2 = Ball-and-stick model of the flecainide molecule
| width2 = 185

<!-- Clinical data -->
| pronounce  = {{IPAc-en|f|l|ɛ|ˈ|k|eɪ|n|aɪ|d}} {{respell|fleh|KAY|nyde}}
| tradename = Tambocor, others
| Drugs.com = {{drugs.com|monograph|flecainide-acetate}}
| MedlinePlus = a608040
| pregnancy_category = 
| class    = [[antiarrhythmic agent|Ic antiarrhythmic]]<ref name=AHFS2019/>
| ATC_prefix = C01
| ATC_suffix = BC04

<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment = 
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment = 
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment = 
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment = 
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment = 
| legal_UK = POM
| legal_UK_comment = 
| legal_US = Rx-only
| legal_US_comment = 
| legal_EU = 
| legal_EU_comment = 
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment = 
| legal_status      = <!-- For countries not listed above -->

<!-- Pharmacokinetic data -->
| bioavailability = 95%
| protein_bound = 40%
| metabolism = [[CYP2D6]] (limited)
| elimination_half-life = 20 hours (range 12–27 hours)
| excretion = [[Kidney]]

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 54143-55-4
| PubChem = 3356
| IUPHAR_ligand = 2560
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01195
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3239
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = K94FTS1806
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07962
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 75984
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 652

<!-- Chemical data -->
| IUPAC_name = (''RS'')-''N''-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide
| C=17 | H=20 | F=6 | N=2 | O=3
| smiles = FC(F)(F)COc2cc(C(=O)NCC1NCCCC1)c(OCC(F)(F)F)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H20F6N2O3/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DJBNUMBKLMJRSA-UHFFFAOYSA-N
}}
<!-- Definition and medical used-->
'''Flecainide''' is a medication used to prevent and treat [[tachyarrhythmia|abnormally fast heart rates]].<ref name=AHFS2019/> This includes [[ventricular tachycardia|ventricular]] and [[supraventricular tachycardia]]s.<ref name=AHFS2019/> Its use is only recommended in those with dangerous arrhythmias or when significant symptoms cannot be managed with other treatments.<ref name=AHFS2019/> Its use does not decrease a person's risk of death.<ref name=AHFS2019/> It is taken [[by mouth]] or [[intravenous|injection into a vein]].<ref name=AHFS2019/><ref name=BNF76/>

<!-- Side effects and mechanism -->
Common side effects include dizziness, problems seeing, shortness of breath, chest pain, and tiredness.<ref name=AHFS2019/> Serious side effects may include [[cardiac arrest]], [[arrhythmia]]s, and [[heart failure]].<ref name=AHFS2019/> It may be used in [[pregnancy]], but has not been well studied in this population.<ref name=BNF76/><ref>{{cite web |title=Flecainide (Tambocor) Use During Pregnancy |url=https://www.drugs.com/pregnancy/flecainide.html |website=Drugs.com |access-date=7 April 2019 |language=en}}</ref> Use is not recommended in those with [[structural heart disease]] or [[ischemic heart disease]].<ref name=AHFS2019/> Flecainide is a class Ic [[antiarrhythmic agent]].<ref name=AHFS2019/> It works by decreasing the entry of [[sodium]] in heart cells, causing prolongation of the [[cardiac action potential]].<ref name=AHFS2019/>

<!-- History and culture -->
Flecainide was approved for medical use in the United States in 1985.<ref name=AHFS2019>{{cite web |title=Flecainide Acetate Monograph for Professionals |url=https://www.drugs.com/monograph/flecainide-acetate.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |access-date=7 April 2019 }}</ref> It is available as a [[generic medication]].<ref name=BNF76>{{cite book|title=British national formulary : BNF 76|date=2018|publisher=Pharmaceutical Press|isbn=9780857113382|pages=103|edition=76}}</ref> In 2021, it was the 205th most commonly prescribed medication in the United States, with more than 2{{nbsp}}million prescriptions.<ref>{{cite web | title=The Top 300 of 2021 | url=https://clincalc.com/DrugStats/Top300Drugs.aspx | website=ClinCalc | access-date=14 January 2024 | archive-date=15 January 2024 | archive-url=https://web.archive.org/web/20240115223848/https://clincalc.com/DrugStats/Top300Drugs.aspx | url-status=live }}</ref><ref>{{cite web | title = Flecainide - Drug Usage Statistics | website = ClinCalc | url = https://clincalc.com/DrugStats/Drugs/Flecainide | access-date = 14 January 2024}}</ref>
{{TOC limit}}