Editing Inositol trisphosphate (section)

{{Chembox
| Name = 1D-myo-inositol 1,4,5-trisphosphate 
| ImageFile = Inositol 1,4,5-trisphosphate.svg
| ImageSize = 200px
| ImageCaption = The inositol trisphosphate trianion
| IUPACName = [(1''R'',2''S'',3''R'',4''R'',5''S'',6''R'')-2,3,5-trihydroxy-4,6-diphosphonooxycyclohexyl] dihydrogen phosphate
| OtherNames = IP<sub>3</sub>; Triphosphoinositol; Inositol 1,4,5-trisphosphate
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 4222
| CASNo = 85166-31-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = MU34XVK5NR
| PubChem = 439456
| ChemSpiderID = 388562
| SMILES = [C@H]1([C@@H]([C@H]([C@@H]([C@H]([C@@H]1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O
| InChI = 1/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2+,3+,4-,5-,6-/m1/s1
| InChIKey = MMWCIQZXVOZEGG-XJTPDSDZBF
| StdInChI = 1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2+,3+,4-,5-,6-/m1/s1
| StdInChIKey = MMWCIQZXVOZEGG-XJTPDSDZSA-N
  }}
|Section2={{Chembox Properties
| Formula = C<sub>6</sub>H<sub>15</sub>O<sub>15</sub>P<sub>3</sub>
| MolarMass = 420.096 g/mol
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility =
  }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt =
  }}
}}

'''Inositol trisphosphate''' or '''inositol 1,4,5-trisphosphate''' abbreviated '''InsP<sub>3</sub>''' or '''Ins3P''' or '''IP<sub>3</sub>''' is an [[inositol phosphate]] signaling molecule. It is made by [[hydrolysis]] of [[phosphatidylinositol 4,5-bisphosphate]] (PIP<sub>2</sub>), a [[phospholipid]] that is located in the [[plasma membrane]], by [[phospholipase C]] (PLC).
Together with [[diglyceride|diacylglycerol]] (DAG), IP<sub>3</sub> is a [[second messenger]] molecule used in [[signal transduction]] in [[cell (biology)|biological cell]]s. While DAG stays inside the membrane, IP<sub>3</sub> is soluble and diffuses through the cell, where it binds to [[Inositol trisphosphate receptor|its receptor]], which is a calcium channel located in the endoplasmic reticulum. When IP<sub>3</sub> binds its receptor, calcium is released into the cytosol, thereby activating various calcium regulated intracellular signals.