Editing Lead styphnate (section)

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 447123478
| ImageFile = Bleistyphnat.png
| ImageSize = 
| PIN = Lead(II) 2,4,6-trinitrobenzene-1,3-bis(olate)
| OtherNames = Lead 2,4,6-trinitrobenzene-1,3-diolate<br />Lead 2,4,6-trinitro-''m''-phenylene dioxide<br />1,3-Benzenediol, 2,4,6-trinitro-, lead(2+) salt (1:1)<br />Lead tricinate<br />Lead trinitroresorcinate<br />Tricinat<ref>ECHA, European Chemicals Agency {{cite web |url=http://echa.europa.eu/documents/10162/13638/svhc_supdoc_lead_styphnate_en.pdf |title=Support document for identification of lead styphnate as a substance of very high concern because of its CMR properties |accessdate=2014-10-17 |url-status=dead |archiveurl=https://web.archive.org/web/20141022103059/http://echa.europa.eu/documents/10162/13638/svhc_supdoc_lead_styphnate_en.pdf |archivedate=2014-10-22 }}</ref>
|Section1 = {{Chembox Identifiers
 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
 | ChemSpiderID = 55674
 | SMILES = c1c(c(c(c(c1[N+](=O)[O-])[O-])[N+](=O)[O-])[O-])[N+](=O)[O-].[Pb+2]
 | InChI = 1/C6H3N3O8.Pb/c10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17;/h1,10-11H;/q;+2/p-2
 | InChIKey = WETZJIOEDGMBMA-NUQVWONBAY
 | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
 | StdInChI = 1S/C6H3N3O8.Pb/c10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17;/h1,10-11H;/q;+2/p-2
 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
 | StdInChIKey = WETZJIOEDGMBMA-UHFFFAOYSA-L
 | CASNo_Ref = {{cascite|correct|??}}
 | CASNo = 15245-44-0
 | UNII_Ref = {{fdacite|correct|CAS}}
 | UNII = 0T8SE91KOP
 | CASNoOther = <!-- deleted CAS numbers 4219-19-6, 6594-85-0, 59286-40-7, 63918-97-8 -->
 | PubChem = 61789
 | EC_number = 239-290-0
 | UNNumber = 0130
 }}
|Section2 = {{Chembox Properties
 | Formula = C<sub>6</sub>HN<sub>3</sub>O<sub>8</sub>Pb
 | MolarMass = 450.288 g/mol
 | Appearance = 
 | Density = 3.06 to 3.1 g cm<sup>−3</sup>
 | MeltingPt = 
 | BoilingPt = 
 | Solubility = 
 }}
|Section3 = {{Chembox Explosive
 | ShockSens = High
 | FrictionSens = High
 | DetonationV = 5200 m/s
 | REFactor = 
 }}
|Section4 = {{Chembox Hazards
 | ExternalSDS = [http://msds.chem.ox.ac.uk/LE/lead_styphnate.html Oxford MSDS]
| GHSPictograms = {{GHS01}}{{GHS07}}{{GHS08}}{{GHS09}}
| GHSSignalWord = danger
| HPhrases      = {{HPhrases|H200|H302|H332|H360Df|H373|H410}}
| PPhrases      = {{PPhrases|}}
| GHS_ref       = <ref>GHS: [https://gestis.dguv.de/data?name=490561 GESTIS 490561]</ref>
 | FlashPt = 
 | NFPA-H = 4
 | NFPA-F = 0
 | NFPA-R = 3
 | AutoignitionPtC = 330
 | AutoignitionPt_notes = 
 }}
}}

'''Lead styphnate''' (lead 2,4,6-[[resorcinol|trinitroresorcinate]], C<sub>6</sub>HN<sub>3</sub>O<sub>8</sub>Pb ), whose name is derived from [[styphnic acid]], is an [[explosive]] used as a component in [[primer (firearm)|primer]] and [[detonator]] mixtures for less sensitive [[secondary explosive]]s.  Lead styphnate is only slightly soluble in [[water]] and [[methanol]].<ref name=":0"/> Samples of lead styphnate vary in color from yellow to gold, orange, reddish-brown, to brown. Lead styphnate is known in various polymorphs, hydrates, and basic salts. Normal lead styphnate monohydrate, monobasic lead styphnate, tribasic lead styphnate dihydrate, and pentabasic lead styphnate dehydrate as well as α, β [[polymorphism (materials science)|polymorphs]] of lead styphnate exist.

Lead styphnate forms six-sided crystals of the [[monohydrate]] and small rectangular crystals.  Lead styphnate is particularly sensitive to fire and the discharge of [[static electricity]]. Long thin crystals are particularly sensitive. Lead styphnate does not react with other metals and is less sensitive to shock and friction than [[Mercury(II) fulminate|mercury fulminate]] or [[Lead(II) azide|lead azide]].  It is stable in storage, even at elevated temperatures. As with other [[lead]]-containing compounds, lead styphnate is toxic owing to [[Heavy metal (chemistry)|heavy metal]] poisoning.