Editing Lipoxin (section)

{{short description|Acronym for lipoxygenase interaction product}}
<!-- The structure diagram should highlight the chiral centers, as the epi-lipoxins differ only in chirality-->
{{Chembox
| verifiedrevid = 444255012
| Name = Lipoxins A<sub>4</sub> and B<sub>4</sub>
|  ImageFile = Lipoxin A4.svg
|  ImageSize = 200px
|  ImageCaption = Lipoxin A<sub>4</sub>
|  ImageFile1 = Lipoxin B4.svg
|  ImageCaption1 = Lipoxin B<sub>4</sub>
|  PIN=A4: (5''S'',6''R'',7''E'',9''E'',11''Z'',13''E'',15''S'')-5,6,15-Trihydroxyicosa-7,9,11,13-tetraenoic acid<br />B4: (5''S'',6''E'',8''Z'',10''E'',12''E'',14''R'',15''S'')-5,14,15-Trihydroxyicosa-6,8,10,12-tetraenoic acid
|  OtherNames = LXA4 and LXB4
|Section1= {{Chembox Identifiers
| IUPHAR_ligand = 1034
| IUPHAR_ligand_Comment = A4
| IUPHAR_ligand1 = 5216
| IUPHAR_ligand1_Comment = B4
| ChemSpiderID = 4444429
| ChemSpiderID_Comment = A4
| ChemSpiderID_Ref = {{chemspidercite|correct|}}
| ChemSpiderID1 = 4444430
| ChemSpiderID1_Comment = B4
| ChemSpiderID1_Ref = {{chemspidercite|correct|}}
| InChI_Comment = A4
| InChI = 1S/C20H32O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h4-7,9-10,13-14,17-19,21-23H,2-3,8,11-12,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,13-9+,14-10+/t17-,18+,19-/m0/s1
| InChIKey = IXAQOQZEOGMIQS-SSQFXEBMSA-N
| InChI1_Comment = B4
| InChI1 = 1S/C20H32O5/c1-2-3-8-14-18(22)19(23)15-10-7-5-4-6-9-12-17(21)13-11-16-20(24)25/h4-7,9-10,12,15,17-19,21-23H,2-3,8,11,13-14,16H2,1H3,(H,24,25)/b6-4-,7-5+,12-9+,15-10+/t17-,18+,19-/m1/s1
| InChIKey1 = UXVRTOKOJOMENI-WLPVFMORSA-N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H32O5/c1-2-3-8-14-18(22)19(23)15-10-7-5-4-6-9-12-17(21)13-11-16-20(24)25/h4-7,9-10,12,15,17-19,21-23H,2-3,8,11,13-14,16H2,1H3,(H,24,25)/b6-4-,7-5+,12-9+,15-10+/t17-,18+,19-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UXVRTOKOJOMENI-WLPVFMORSA-N
| CASNo_Comment = A4
| CASNo_Ref = {{cascite|correct}}
| CASNo = 89663-86-5
| CASNo1_Comment = B4
| CASNo1_Ref = {{cascite|correct}}
| CASNo1 = 98049-69-5
| PubChem_Comment = A4
| PubChem = 5280914
| PubChem1_Comment = B4
| PubChem1 = 5280915
| ChEBI = 6498
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI1 = 6499
| ChEBI1_Ref = {{ebicite|correct|EBI}}
| SMILES_Comment = A4
| SMILES = CCCCC[C@H](O)C=C\C=C/C=CC=CC(O)C(O)CCCC(O)=O
| SMILES1_Comment = B4
| SMILES1 = O=C(O)CCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCCC
}}
|Section2= {{Chembox Properties
|  Formula=C<sub>20</sub>H<sub>32</sub>O<sub>5</sub>
|  MolarMass=352.46508 g/mol
  }}
}}
A '''lipoxin''' ('''LX''' or '''Lx'''), an acronym for [[lipoxygenase]] interaction product, is a bioactive [[autacoid]] metabolite of [[arachidonic acid]] made by various cell types. They are categorized as [[nonclassic eicosanoid]]s and members of the [[specialized pro-resolving mediator]] (SPM) family of [[polyunsaturated fatty acid]] (PUFA) metabolites. Like other SPMs, LXs form during an [[inflammatory response]] and act to resolve it. The first lipoxins identified were lipoxin A<sub>4</sub> (LXA<sub>4</sub>) and lipoxin B<sub>4</sub> (LXB<sub>4</sub>), followed by their respective [[epimer]]s, the [[epi-lipoxin]]s 15-epi-LXA<sub>4</sub> and 15-epi-LXB<sub>4</sub>.