Editing Lycopene (section)

{{Short description|Carotenoid pigment}}
{{chembox
| Watchedfields = changed
| verifiedrevid = 464394622
| ImageFile = Lycopene powder.jpg
| ImageSize1 = 150px
| ImageFile2 = Lycopene.svg
| ImageSize2 = 300px
| ImageFile3 = Lycopene-3D-balls-(rotated).png
| ImageSize3 = 300px
| IUPACName = ψ,ψ-Carotene
| SystematicName = (6''E'',8''E'',10''E'',12''E'',14''E'',16''E'',18''E'',20''E'',22''E'',24''E'',26''E'')-2,6,10,14,19,23,27,31-Octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene
| OtherNames = 
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 394156
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 501174
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SB0N2N0WV6
| InChI = 1/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+
| InChIKey = OAIJSZIZWZSQBC-GYZMGTAEBZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OAIJSZIZWZSQBC-GYZMGTAESA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 502-65-8
| PubChem = 446925
| EINECS = 207-949-1
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15948
| SMILES = C(\C=C\C=C(\CC/C=C(\C)C)C)(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(\C)CC\C=C(/C)C)C)C)C)C
}}
|Section2={{Chembox Properties
| C=40 | H=56
| Appearance = deep red solid
| Density = 0.889 g/cm<sup>3</sup>
| MeltingPtC = 177
| MeltingPt_ref =<ref>{{cite book | editor= Haynes, William M. | year = 2011 | title = CRC Handbook of Chemistry and Physics | edition = 92nd | publisher = [[CRC Press]] | isbn = 978-1439855119|page=3.94| title-link = CRC Handbook of Chemistry and Physics }}</ref>
| BoilingPtC = 660.9
| BoilingPt_notes = <br> at 760 mmHg<ref name=ec21 />
| Solubility = insoluble
| SolubleOther = soluble in [[carbon disulfide|CS<sub>2</sub>]], [[chloroform|CHCl<sub>3</sub>]], [[tetrahydrofuran|THF]], [[diethyl ether|ether]], [[hexane|C<sub>6</sub>H<sub>14</sub>]], [[vegetable oil]]<br> insoluble in [[methanol|CH<sub>3</sub>OH]], [[ethanol|C<sub>2</sub>H<sub>5</sub>OH]]<ref name=ec21>{{cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/lycopene|title=Lycopene|publisher=PubChem, US National Library of Medicine|date=2016|access-date=13 October 2016}}</ref>
| Solubility1 = 1 g/L (14 °C)<ref name=ec21 />
| Solvent1 = hexane
| RefractIndex = 
| VaporPressure = 1.33·10<sup>−16</sup> mmHg (25 °C)<ref name=ec21 />
  }}
|Section3={{Chembox Hazards
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
| MainHazards = Combustible
| FlashPtC = 350.7
| FlashPt_ref = <ref name=ec21 />
| AutoignitionPt =
  }}
}}

'''Lycopene''' is an [[organic compound]] classified as a [[tetraterpene]] and a [[carotene]].<ref name=KO>{{cite book |doi=10.1002/0471238961.2005181602120504.a01.pub2|chapter=Terpenoids |title=Kirk-Othmer Encyclopedia of Chemical Technology |year=2006 |last1=Sell |first1=Charles S. |isbn=0471238961 }}</ref> Lycopene (from the [[Neo-Latin]] ''[[Lycopersicon]]'', the name of a former tomato genus) is a bright red [[carotenoid]] [[hydrocarbon]] found in [[tomato]]es and other red fruits and vegetables.