Editing Parathion (section)

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 431610740
| Name = Parathion
| ImageFile=Methyl&Ethylparathion.png
| ImageFile1=Ethyl-parathion-from-AHRLS-2011-3D-balls.png
| PIN = ''O'',''O''-Diethyl ''O''-(4-nitrophenyl) phosphorothioate
| OtherNames = E605
|Section1={{Chembox Identifiers
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 27928
| SMILES = S=P(Oc1ccc(cc1)[N+]([O-])=O)(OCC)OCC
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13844817
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 61G466064D
| InChI = 1/C10H14NO5PS/c1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3
| InChIKey = LCCNCVORNKJIRZ-UHFFFAOYAR
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 261919
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14NO5PS/c1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LCCNCVORNKJIRZ-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 56-38-2
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C06604
| PubChem = 991
| RTECS = TF4550000
| EC_number = 200-271-7
| UNNumber = 3018 2783
| Beilstein = 2059093
  }}
|Section2={{Chembox Properties
| C=10 | H=14 | N=1 | O=5 | P=1 | S=1
| Appearance = White crystals (pure form)
| Solubility = 24 mg/L
| SolubleOther = high solubility in [[xylene]] and [[1-Butanol|butanol]]
| Solvent = other solvents
| MeltingPtC = 6
  }}
|Section7={{Chembox Hazards
| ExternalSDS = [https://www.cdc.gov/niosh/ipcsneng/neng0006.html]
| NFPA-H = 4
| NFPA-F = 1
| NFPA-R = 2
| NFPA-S = 
| FlashPtC = 120
| GHSPictograms = {{GHS06}}{{GHS08}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|300|311|330|372|410}}
| PPhrases = {{P-phrases|260|264|270|271|273|280|284|301+310|302+352|304+340|310|312|314|320|321|322|330|361|363|391|403+233|405|501}}
| PEL = none (methyl parathion),<ref name=PGCH|0427>{{PGCH|0427}}</ref> TWA 0.1 mg/m<sup>3</sup> [skin] (ethyl parathion)<ref name=PGCH|0479/>
| REL = TWA 0.2 mg/m<sup>3</sup> [skin] (methyl parathion)<ref name=PGCH|0427/> TWA 0.05 mg/m3 [skin] (ethyl parathion)<ref name=PGCH|0479/>
| IDLH = N.D. (methyl parathion)<ref name=PGCH|0427/> 10 mg/m<sup>3</sup> (ethyl parathion)<ref name=PGCH|0479>{{PGCH|0479}}</ref>
| LCLo = 50 mg/m<sup>3</sup> (rabbit, 2 hr)<br/>14 mg/m<sup>3</sup> (guinea pig, 2 hr)<br/>15 mg/m<sup>3</sup> (mouse)<ref name=IDLH>{{IDLH|56382|Parathion}}</ref>
| LC50 = 84 mg/m<sup>3</sup> (rat, 4 hr)<ref name=IDLH/>
| LD50 = 5 mg/kg (mouse, oral)<br/>10 mg/kg (rabbit, oral)<br/>3 mg/kg (dog, oral)<br/>0.93 mg/kg (cat, oral)<br/>5 mg/kg (horse, oral)<br/>8 mg/kg (guinea pig, oral)<br/>2 mg/kg (rat, oral)<ref name=IDLH/>
  }}<ref>{{cite web |url=http://www.ehs.neu.edu/laboratory_safety/general_information/nfpa_hazard_rating/documents/NFPAratingJR.htm |title=Hazard Rating Information for NFPA Fire Diamonds |access-date=2015-03-13 |url-status=dead |archive-url=https://web.archive.org/web/20150217114741/http://www.ehs.neu.edu/laboratory_safety/general_information/nfpa_hazard_rating/documents/NFPAratingJR.htm |archive-date=2015-02-17 }}</ref>
}}

'''Parathion''', also called '''parathion-ethyl''' or '''diethyl parathion''', is an [[organophosphate]] [[insecticide]] and [[acaricide]]. It was originally developed by [[IG Farben]] in the 1940s. It is highly toxic to non-target organisms, including humans, so its use has been banned or restricted in most countries. In response to safety concerns, the less toxic but still dangerous analogue [[parathion methyl]] was later developed.<ref>{{Cite web|url=http://www.fao.org/3/w5715e/w5715e05.htm|title=Parathion|website=www.fao.org|access-date=2020-04-17}}</ref>