Editing Pergolide (section)

{{Short description|Dopamine agonist medication}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 464199003
| image = Pergolide.svg
| image_class = skin-invert-image
| width = 200
| alt = <!--Clinical data-->
| image2 = PergolideMV.png
| width2 = 240
| tradename = Permax, Prascend (veterinary), others
| Drugs.com = {{drugs.com|monograph|pergolide-mesylate}}
| pregnancy_category = B
| legal_BR = C1
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref>
| legal_CA = Rx-only
| legal_CA_comment = 
| legal_US = 
| legal_US_comment = Veterinary use only, withdrawn for human use
| routes_of_administration = [[Oral administration|Oral]]

<!--Pharmacokinetic data-->| bioavailability = 
| protein_bound = 90%
| metabolism = Extensively Hepatic
| elimination_half-life = 27 hours
| excretion = <!--Identifiers-->
| IUPAC_name = (6a''R'',9''R'',10a''R'')-9-(methylthiomethyl)-7-propyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-''fg'']quinoline
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 66104-22-1
| ATC_prefix = N04
| ATC_suffix = BC02
| PubChem = 47811
| IUPHAR_ligand = 48
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01186
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 43503
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 24MJ822NZ9
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08339
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 63617
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 531
| synonyms = 8β-[(Methylthio)methyl]-6-propylergoline

<!--Chemical data-->| C = 19
| H = 26
| N = 2
| S = 1
| SMILES = [H][C@]12C[C@@H](CSC)CN(CCC)[C@]1([H])Cc3c[nH]c4cccc2c34
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H26N2S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3/t13-,16-,18-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YEHCICAEULNIGD-MZMPZRCHSA-N
}}

'''Pergolide''', sold under the brand name '''Permax''' and '''Prascend''' (veterinary) among others, is an [[ergoline]]-based [[dopamine receptor]] [[agonist]] used in some countries for the [[therapy|treatment]] of [[Parkinson's disease]]. Parkinson's disease is associated with reduced [[dopamine]] synthesis in the [[substantia nigra]] of the [[brain]]. Pergolide acts on many of the same receptors as dopamine to increase receptor activity.

<!-- Society and culture -->
It was patented in 1978<ref name="US4166182A">{{cite patent |country=US |number=4166182A |status=patent |title=6-n-propyl-8-methoxymethyl or methylmercaptomethylergolines and related compounds |pubdate=1979-08-28 |gdate=1979-08-28 |fdate=1978-02-08 |pridate=1978-02-08 |invent1=Edmund C. Kornfeld |invent2=Nicholas J. Bach |assign1=Eli Lilly and Co}}</ref> and approved for medical use in 1989.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=533 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA533 |language=en}}</ref> In 2007, pergolide was withdrawn from the U.S. market for human use after several published studies revealed a link between the drug and increased rates of [[valvular heart disease]].<ref>{{cite web | url = https://www.fda.gov/cder/drug/advisory/pergolide.htm | work = FDA Public Health Advisory | title = Pergolide (marketed as Permax) | access-date = 2019-12-16 | archive-date = 2007-04-08 | archive-url = https://web.archive.org/web/20070408111551/https://www.fda.gov/cder/drug/advisory/pergolide.htm | url-status = bot: unknown }}</ref> However, a veterinary form of pergolide, marketed under the trade name Prascend, is permitted for the treatment of [[pituitary pars intermedia dysfunction]] (PPID) also known as equine Cushing's syndrome (ECS) in horses.<ref name = "Forney">{{Cite web | vauthors = Forney B |url=http://www.wedgewoodpetrx.com/learning-center/professional-monographs/pergolide-for-veterinary-use.html|title=Pergolide for Veterinary Use}}</ref>