Editing Poly(methyl methacrylate) (section)

{{Short description|Transparent thermoplastic, commonly called acrylic}}
{{About|the transparent plastic sometimes called acrylic glass|the glass/plastic laminate often called "safety glass"|Laminated glass|other uses|Acrylic (disambiguation)}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477162877
| ImageFile = PMMA repeating unit.svg
| ImageSize = 100px
| IUPACName = Poly(methyl 2-methylpropenoate)
| SystematicName =
| OtherNames = {{ubl
 | Poly(methyl methacrylate)
 | PMMA
 | Methyl methacrylate resin
 | Perspex
 }}
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 9011-14-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Z47NNT4J11
| EINECS =
| PubChem =
| SMILES = CCC(C)(C(=O)OC)CC(C)(C(=O)OC)CC(C)(C(=O)OC)CC(C)(C(=O)OC)CC(C)(C(=O)OC)C
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = None
| InChI =
| RTECS =
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C19504
}}
|Section2={{Chembox Properties
| Formula = {{chem2|([[carbon|C]]5[[hydrogen|H]]8[[oxygen|O]]2)_{''n''}|}}
| MolarMass = Varies
| Appearance =
| Density = 1.18{{nbsp}}g/cm{{sup|3}}<ref name=p1/>
| MeltingPtC = 
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent = Chloroform (poor)
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb =
| RefractIndex = 1.4905 at 589.3{{nbsp}}nm<ref name=refr/>
| MagSus = −9.06×10{{sup|−6}} (SI, 22{{nbsp}}°C)<ref>{{cite journal |last1=Wapler |first1=M. C. |last2=Leupold |first2=J. |last3=Dragonu |first3=I. |last4=von Elverfeldt |first4=D. |last5=Zaitsev |first5=M. |last6=Wallrabe |first6=U. |title=Magnetic properties of materials for MR engineering, micro-MR and beyond |journal=JMR |date=2014 |volume=242 |issue=2014 |pages=233–242 |doi=10.1016/j.jmr.2014.02.005 |pmid=24705364 |arxiv=1403.4760 |bibcode=2014JMagR.242..233W |s2cid=11545416}}</ref>
}}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =}}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US =
}}
|Section7={{Chembox Hazards
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| HPhrases = 
| PPhrases = 
| GHS_ref  = 
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL =
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds =
}}
}}
[[File:Lichtenberg figure in block of Plexiglas.jpg|thumb|right|[[Lichtenberg figure]]: high-voltage dielectric breakdown in an acrylic polymer block]]

'''Poly'''('''methyl methacrylate''') ('''PMMA''') is a [[list of synthetic polymers|synthetic polymer]] derived from [[methyl methacrylate]]. It is a [[transparency (optics)|transparent]] [[thermoplastic]], used as an [[engineering plastic]]. PMMA is also known as '''acrylic''', '''acrylic glass''', as well as by the trade names and brands '''Crylux''', '''Walcast''', '''Hesalite''', '''Plexiglas''', '''Acrylite''', '''Lucite''', '''PerClax''', and '''Perspex''', among several others ([[#Names|see below]]). This plastic is often used in sheet form as a lightweight or shatter-resistant alternative to [[soda-lime glass|glass]]. It can also be used as a casting resin, in inks and coatings, and for many other purposes.

It is often technically classified as a type of [[glass]], in that it is a non-crystalline vitreous substance—hence its occasional historic designation as ''acrylic glass''.