Editing Pyritinol (section)

{{Short description|Chemical compound}}
{{Infobox drug
| Verifiedfields = changed
| verifiedrevid = 464377508
| IUPAC_name = 5,5'-[dithiobis(methylene)]bis[4-(hydroxymethyl)-2-methylpyridin-3-ol]
| image = Pyritinol.svg
| image_class = skin-invert-image

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| elimination_half-life = 2.5 hours
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 1098-97-1
| ATC_prefix = N06
| ATC_suffix = BX02
| PubChem = 14190
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13561
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AK5Q5FZH2R
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02160
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 488093

<!--Chemical data-->
| C=16 | H=20 | N=2 | O=4 | S=2 
| smiles = Oc1c(c(cnc1C)CSSCc2c(c(O)c(nc2)C)CO)CO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20N2O4S2/c1-9-15(21)13(5-19)11(3-17-9)7-23-24-8-12-4-18-10(2)16(22)14(12)6-20/h3-4,19-22H,5-8H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SIXLXDIJGIWWFU-UHFFFAOYSA-N
}}

'''Pyritinol''' also called pyridoxine disulfide or pyrithioxine (European drug names Encephabol, Encefabol, Cerbon 6) is a semi-synthetic water-soluble analog of [[vitamin B6|vitamin B<sub>6</sub>]] (Pyridoxine HCl). It was produced in 1961 by Merck Laboratories by bonding 2 vitamin B<sub>6</sub> compounds ([[pyridoxine]]) together with a disulfide bridge. Since the 1970s, it has been a prescription and OTC drug in several countries for cognitive disorders, rheumatoid arthritis,<ref>{{cite journal | vauthors = Lemmel EM | title = Comparison of pyritinol and auranofin in the treatment of rheumatoid arthritis. The European Multicentre Study Group | journal = British Journal of Rheumatology | volume = 32 | issue = 5 | pages = 375–82 | date = May 1993 | pmid = 8495257 | doi = 10.1093/rheumatology/32.5.375 }}</ref> and learning disorders in children. Since the early 1990s it has been sold as a [[nootropic]] [[dietary supplement]] in the United States.