Editing Pyrophosphate (section)

{{Short description|Class of chemical compounds}}
{{Hatnote|"Diphosphate" redirects here. It can also refer to any salt containing two [[phosphate]] groups.}}
{{Chembox
| verifiedrevid = 1276963742
| ImageFile = Pyrophosphate_anion.png
| ImageFile1 = Pyrophosphate-3D-balls.png
| ImageAlt1 = 
| ImageCaption1 = {{legend|orange|[[Phosphorus]], P}}{{legend|red|[[Oxygen]], O}}
| ImageName1 = Pyrophosphate anion
| IUPACName = Diphosphate
| SystematicName = Dipolyphosphate
| OtherNames = Pyrophosphate<br/>Phosphonatophosphate
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 14000-31-8
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 13472-36-1
| CASNo2_Comment = (tetrasodium decahydrate salt)
| CASNo3_Ref = {{cascite|correct|CAS}}
| CASNo3 = 7758-16-9
| CASNo3_Comment = (disodium salt)
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 18361
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 559142
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04160
| KEGG = 
| Gmelin = 26938
| UNII = X3SSV2V6L3
| InChI = 1/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| InChIKey = XPPKVPWEQAFLFU-XBHQNQODAI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XPPKVPWEQAFLFU-UHFFFAOYSA-J
| PubChem = 644102
| SMILES = [O-]P(=O)([O-])OP(=O)([O-])[O-]
}}
|Section2={{Chembox Properties
| Formula = {{chem2|P2O7(4-)}}
| P=2|O=7
| ConjugateAcid = [[Pyrophosphoric acid]]
}}
|Section3={{Chembox Hazards
| MainHazards = 
}}
}}
In [[chemistry]], '''pyrophosphates''' are [[phosphorus]] [[oxyanion]]s that contain two phosphorus atoms in a {{chem2|P\sO\sP}} linkage. A number of pyrophosphate salts exist, such as [[disodium pyrophosphate]] ({{chem2|Na2H2P2O7}}) and [[tetrasodium pyrophosphate]] ({{chem2|Na4P2O7}}), among others. Often pyrophosphates are called '''diphosphates'''. The parent pyrophosphates are derived from partial or complete neutralization of [[pyrophosphoric acid]]. The '''pyrophosphate bond''' is also sometimes referred to as a phosphoanhydride bond, a naming convention which emphasizes the loss of water that occurs when two phosphates form a new {{chem2|P\sO\sP}} bond, and which mirrors the nomenclature for [[Organic acid anhydride|anhydrides of carboxylic acids]]. Pyrophosphates are found in [[Adenosine triphosphate|ATP]] and other [[nucleotide]] triphosphates, which are important in biochemistry. The term pyrophosphate is also the name of [[ester]]s formed by the condensation of a phosphorylated biological compound with [[inorganic phosphate]], as for [[dimethylallyl pyrophosphate]]. This bond is also referred to as a [[high-energy phosphate]] bond.