Editing Quinoline Yellow WS (section)

{{Short description | "Mixture of water-soluble organic compounds from Quinoline Yellow dye"}}
{{Use dmy dates|date=June 2023}} 
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477001473
| Reference = <ref>{{Cite web|url=http://www.chemicalland21.com/specialtychem/finechem/QUINOLINE%20YELLOW%20WS.htm|title=QUINOLINE YELLOW WS (C.I. ACID YELLOW 3)|accessdate=30 June 2023}}</ref>
| ImageFile = Quinoline Yellow WS.svg
| ImageSize = 
| IUPACName = Sodium 2-(1,3-dioxoindan-2-yl)quinolinedisulfonate
| OtherNames = {{Unbulleted list|C.I. Acid Yellow 3|Food Yellow 13|D&C Yellow No. 10|Acid yellow 3|Quinidine Yellow KT|Japan Yellow 203|Lemon Yellow ZN 3|C.I. 47005}}
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23070
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 35SW5USQ3G
| InChI1 = 1/C18H11NO8S2.2Na/c20-17-11-3-1-2-4-12(11)18(21)15(17)13-6-5-9-7-10(28(22,23)24)8-14(16(9)19-13)29(25,26)27;;/h1-8,15H,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2
| InChIKey1 = FZUOVNMHEAPVBW-NUQVWONBAX
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 8004-92-0
| PubChem = 24671
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H11NO8S2.2Na/c20-17-11-3-1-2-4-12(11)18(21)15(17)13-6-5-9-7-10(28(22,23)24)8-14(16(9)19-13)29(25,26)27;;/h1-8,15H,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FZUOVNMHEAPVBW-UHFFFAOYSA-L
| SMILES = [Na+].[Na+].[O-]S(=O)(=O)c1cc(cc2ccc(nc12)C4C(=O)c3ccccc3C4=O)S([O-])(=O)=O
| EINECS = 305-897-5
  }}
|Section2={{Chembox Properties
| Formula = C<sub>18</sub>H<sub>13</sub>NO<sub>5/8/11</sub>S<sub>1/2/3</sub>Na<sub>1/2/3</sub>
| MolarMass = 477.38 g/mol
| Appearance = Greenish yellow powder
| Density = 
| MeltingPtC = 150
| MeltingPt_notes = (decomposes)
| BoilingPt = 
| pKa = 1.8
| Solubility = Soluble<ref>[http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-371.pdf Additives] FAO {{dead link|date=June 2023}}</ref>
  }}
|Section3={{Chembox Hazards
| Hazards_ref = <ref>{{cite web |title=Quinoline Yellow for microscopy (Hist.), mixture of mono- and disulfonic acid sodium salt |url=https://www.sigmaaldrich.com/AU/en/product/SIGMA/22680 |publisher=Sigma Aldrich}}</ref>
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|302}}
| PPhrases = {{P-phrases|264|270|301+312|501}}
| AutoignitionPt = 
 }}
}}

'''Quinoline Yellow WS''' is a mixture of [[organic compound]]s derived from the dye [[Quinoline Yellow SS]] (spirit soluble).  Owing to the presence of [[sulfonate]] groups, the WS dyes are water-soluble (WS).  It is a mixture of disulfonates (principally), monosulfonates and trisulfonates of 2-(2-quinolyl)indan-1,3-dione with a maximum absorption wavelength of 416&nbsp;nm.<ref>{{cite book|title=Guide to specifications for general notices: general analytical techniques, identification tests, test solutions, and other reference materials|url=https://archive.org/details/bub_gb_c5eGqo7OgVIC|year=1991|publisher=Food and Agriculture Organization of the United Nations|location=Rome|isbn=9789251029916|author=Joint FAO/WHO Expert Committee on Food Additives|edition=Rev. 2 [= ed. 1991]}}</ref><sup>p.&nbsp;119</sup>