Editing Sorbitol (section)

{{cs1 config|name-list-style=vanc}}

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477859013
| Name = 
| ImageFile = D-sorbitol.svg
| ImageSize = 220px
| ImageFile1 = Sorbitol-3D-balls.png
| ImageSize1 = 220px
|IUPACName=<small>D</small>-Glucitol<ref>publications.iupac.org/pac/1996/pdf/6810x1919.pdf</ref>
| SystematicName = (2''S'',3''R'',4''R'',5''R'')-Hexane-1,2,3,4,5,6-hexol
| OtherNames = <small>D</small>-Sorbitol; Sorbogem; Sorbo
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 5576
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1682
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 506T60A25R
| KEGG = C00794
| InChI = 1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1
| InChIKey = FBPFZTCFMRRESA-JGWLITMVSA
| StdInChI_Ref = {{stdinchicite|changed|pubchem}}
| StdInChI = 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|pubchem}}
| StdInChIKey = FBPFZTCFMRRESA-JGWLITMVSA-N
| CASNo = 50-70-4
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 5780
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01638
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 17924
| SMILES = OC([C@H](O)[C@@H](O)[C@H](O)CO)CO
| MeSHName = Sorbitol
  }}
| Section2 = {{Chembox Properties
| C=6 | H=14 | O=6
| MolarMass = 182.17 g/mol
| Appearance = White crystalline powder
| Density = 1.49 g/cm<sup>3</sup><ref name=GESTIS>{{GESTIS|ZVG=30670}}</ref>
| MeltingPtC = 94–96
| MeltingPt_ref = <ref name=GESTIS/>
| Solubility = 2350 g/L<ref name=GESTIS/>
| BoilingPtC = 
| MagSus = −107.80·10<sup>−6</sup> cm<sup>3</sup>/mol
| LogP =−4.67<ref name="chemsrc">{{cite web|url=https://www.chemsrc.com/en/cas/50-70-4_904692.html|title=Sorbitol_msds}}</ref>
  }}
| Section3 = 
| Section4 = 
| Section5 = 
| Section6 = {{Chembox Pharmacology
| ATCCode_prefix = A06
| ATCCode_suffix = AD18
| ATC_Supplemental = {{ATC|A06|AG07}} {{ATC|B05|CX02}} {{ATC|V04|CC01}}
}}
| Section7 = {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R = 0
| MainHazards =
| FlashPt = >
| FlashPtC= 100
| FlashPt_ref = <ref name=GESTIS/>
| AutoignitionPtC = 420
| AutoignitionPt_ref = <ref name=GESTIS/>
  }}
}}

'''Sorbitol''' ({{IPAc-en|ˈ|s|ɔː|(|r|)|b|ᵻ|t|ɒ|l}}), less commonly known as '''glucitol''' ({{IPAc-en|ˈ|g|l|uː|s|ᵻ|t|ɒ|l}}), is a [[sugar alcohol]] with a [[sweet]] [[taste]] which the human body metabolizes slowly. It can be obtained by [[Redox|reduction]] of [[glucose]], which changes the converted [[aldehyde]] group (−CHO) to a primary alcohol group (−CH<sub>2</sub>OH). Most sorbitol is made from [[potato starch]], but it is also found in nature, for example in apples, pears, peaches, and prunes.<ref name=Teo>{{cite journal | pmid = 17132742 | year = 2006 | last1 = Teo | first1 = G | last2 = Suzuki | first2 = Y | last3 = Uratsu | first3 = SL | last4 = Lampinen | first4 = B | last5 = Ormonde | first5 = N | last6 = Hu | first6 = WK | last7 = Dejong | first7 = TM | last8 = Dandekar | first8 = AM | title = Silencing leaf sorbitol synthesis alters long-distance partitioning and apple fruit quality | volume = 103 | issue = 49 | pages = 18842–7 | doi = 10.1073/pnas.0605873103 | pmc = 1693749 | journal = Proceedings of the National Academy of Sciences of the United States of America| bibcode = 2006PNAS..10318842T | doi-access = free }}</ref> It is converted to [[fructose]] by [[sorbitol-6-phosphate 2-dehydrogenase]]. Sorbitol is an [[isomer]] of [[mannitol]], another sugar alcohol; the two differ only in the orientation of the [[hydroxyl]] group on carbon{{nbs}}2.<ref name="Kearsley, M. W. pp 249-249">Kearsley, M. W.; Deis, R. C. Sorbitol and Mannitol. In Sweeteners and Sugar Alternatives in Food Technology; Ames: Oxford, 2006; pp 249-249-261.</ref> While similar, the two sugar alcohols have very different sources in nature, [[melting point]]s, and uses.

As an [[over-the-counter drug]], sorbitol is used as a [[laxative]] to treat [[constipation]].<ref name="drugs">{{cite web |title=Sorbitol |url=https://www.drugs.com/mtm/sorbitol.html |publisher=Drugs.com |access-date=8 July 2022 |date=23 November 2021}}</ref>