Editing Vardenafil (section)

{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Use mdy dates|date=March 2024}}
{{Drugbox
| verifiedrevid = 458460083
| IUPAC_name = 4-[2-Ethoxy-5-(4-ethylpiperazin-1-yl)sulfonyl-phenyl]-9-methyl-7-propyl-3,5,6,8-tetrazabicyclo[4.3.0]nona-3,7,9-trien-2-one
| image = Vardenafil structure.svg
| width = 250

<!--Clinical data-->
| tradename = Levitra, Staxyn, Vivanza
| Drugs.com = {{drugs.com|monograph|vardenafil-hydrochloride}}
| MedlinePlus = a603035
| pregnancy_AU = B3
| licence_EU = yes
| routes_of_administration = [[Oral administration|By mouth]]
| ATC_prefix = G04
| ATC_suffix = BE09
| ATC_supplemental =

| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| legal_US_comment = <ref name="Levitra FDA label">{{cite web | title=Levitra (vardenafil hydrochloride) tablets, for oral use Initial U.S. Approval: 2003 | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/archives/fdaDrugInfo.cfm?archiveid=595067 | access-date=April 3, 2023}}</ref>
| legal_status = Rx-only

<!--Pharmacokinetic data-->
| bioavailability = 15%
| protein_bound = 95%
| metabolism = [[Liver]] ([[CYP3A4]])
| elimination_half-life = 4–5 hours
| excretion = [[Bile duct]]

<!--Identifiers-->
| IUPHAR_ligand = 7320
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 224785-90-4
| PubChem = 110634
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00862
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 99300
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UCE6F4125H
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1520
| KEGG = D08668

<!--Chemical data-->
| C=23 | H=32 | N=6 | O=4 | S=1
| smiles = O=C2\N=C(/Nn1c(nc(c12)C)CCC)c3cc(ccc3OCC)S(=O)(=O)N4CCN(CC)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H32N6O4S/c1-5-8-20-24-16(4)21-23(30)25-22(26-29(20)21)18-15-17(9-10-19(18)33-7-3)34(31,32)28-13-11-27(6-2)12-14-28/h9-10,15H,5-8,11-14H2,1-4H3,(H,25,26,30)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SECKRCOLJRRGGV-UHFFFAOYSA-N
}}
[[File:Sexual enhancer (phosphodiesterase-5 inhibitors) - Vardenafil - Aristo Pharma - Vardenaristo - 4 tablets Blister 20 mg - Image 002.jpg|thumb|Vardenafil  4 tablets Blister 20 mg]]
'''Vardenafil''', sold under the brand name '''Levitra''' among others, is a [[medication]] that is used for treating [[erectile dysfunction]].<ref name="Levitra FDA label" /><ref>{{cite web|url=https://deutschemedz.de/levitra/|title=Levitra (Vardenafil) is A Drug Used to Treat Erectile Problems in Men|access-date=May 12, 2010|publisher=Deutschemedz|language=de}}</ref> It is a [[PDE5 inhibitor]].<ref name="Levitra FDA label" /> It is taken [[by mouth]].<ref name="Levitra FDA label" />