Editing Zirconium tungstate (section)

{{More citations needed|date=August 2024}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470637657
| Name = Zirconium(IV) tungstate
| ImageFile = ZrW2O8 opaque polyhedra.svg
| ImageName = Zirconium(IV) tungstate
| OtherNames = zirconium tungsten oxide
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 16853-74-0
| ChemSpiderID = 10710102
| EINECS =  240-876-3
| PubChem = 21954342
| StdInChI=1S/8O.2W.Zr/q;;;;4*-1;;;+4
| StdInChIKey = OJLGWNFZMTVNCX-UHFFFAOYSA-N
| SMILES = [O-][W](=O)(=O)[O-].[O-][W](=O)(=O)[O-].[Zr+4]
  }}
|Section2={{Chembox Properties
| Formula = Zr(WO<sub>4</sub>)<sub>2</sub>
| MolarMass = 586.92 g/mol
| Appearance = white powder
| Density = 5.09 g/cm<sup>3</sup>, solid
| Solubility = negligible
| MeltingPt =
| BoilingPt =
  }}
|Section7={{Chembox Hazards
| ExternalSDS = [https://web.archive.org/web/20100201192127/http://www.espi-metals.com/msds's/zirconiumtungstate.pdf MSDS]
| GHS_ref=<ref>{{cite web |title=C&L Inventory |url=https://echa.europa.eu/information-on-chemicals/cl-inventory-database/-/discli/details/111452 |website=echa.europa.eu |access-date=8 December 2021}}</ref>
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|315|319|335}}
| PPhrases = {{P-phrases|}}
| NFPA-H = 2
| NFPA-R = 0
| NFPA-F = 0
  }}
}}

'''Zirconium tungstate''' is the [[zirconium]] [[ionic salt|salt]] of [[tungstic acid]] with the formula {{chem2|Zr(WO4)2}}. The phase formed at ambient pressure by reaction of [[zirconia|ZrO<sub>2</sub>]] and [[tungsten oxide|WO<sub>3</sub>]] is a [[metastable]] [[cubic phase]], which has [[negative thermal expansion]] characteristics, namely it shrinks over a wide range of temperatures when heated.<ref>{{cite journal|title=Negative Thermal Expansion from 0.3 to 1050 Kelvin in ZrW<sub>2</sub>O<sub>8</sub>|journal=Science|date=1996-04-05|first=T. A.|last=Mary|author2=J. S. O. Evans |author3=T. Vogt |author4=A. W. Sleight |volume=272|issue=5258|pages=90–92|doi= 10.1126/science.272.5258.90|url=http://www.sciencemag.org/cgi/content/abstract/272/5258/90|access-date=2008-02-20|bibcode=1996Sci...272...90M|s2cid=54599739|url-access=subscription}}</ref> In contrast to most other ceramics exhibiting negative CTE (coefficient of thermal expansion), the CTE of ZrW<sub>2</sub>O<sub>8</sub> is isotropic and has a large negative magnitude (average CTE of −7.2 × 10<sup>−6</sup>K<sup>−1</sup>) over a wide range of temperature (−273&nbsp;°C to 777&nbsp;°C).<ref>{{cite journal|title=Isotropic Negative Thermal Expansion|journal=Annu. Rev. Mater. Sci.|year=1998|first=A.W.|last=Sleight|volume=28|pages=29–43|doi=10.1146/annurev.matsci.28.1.29|bibcode = 1998AnRMS..28...29S }}</ref> A number of other [[phase (matter)|phases]] are formed at high pressures.