Editing Deoxyadenosine

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 460775595
|ImageFile=Desoxyadenosin.svg
|ImageSize=160px
|ImageAlt = Skeletal formula of deoxyadenosine
|ImageFile1 = Deoxyadenosine-3D-spacefill.png
|ImageSize1 = 180
|ImageAlt1 = Space-filling model of the deoxyadenosine molecule
|IUPACName = (2''R'',3''S'',5''R'')-5-(6-Amino-9''H''-purin-9-yl)-2-(hydroxymethyl)oxolan-3-ol
|OtherNames = 2′-Deoxyadenosine; α-Deoxyadenosine; dA
|Section1= {{Chembox Identifiers
| IUPHAR_ligand = 5109
|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13135
| InChI = 1/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1
| InChIKey = OLXZPDWKRNYJJZ-RRKCRQDMBK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OLXZPDWKRNYJJZ-RRKCRQDMSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=958-09-8
|  PubChem=636
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 416340
|  UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P582C98ULC
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17256
| SMILES = n2c1c(ncnc1n(c2)[C@@H]3O[C@@H]([C@@H](O)C3)CO)N
|  MeSHName=2'-deoxyadenosine
  }}
|Section2= {{Chembox Properties
|  Formula=C<sub>10</sub>H<sub>13</sub>N<sub>5</sub>O<sub>3</sub>
|  MolarMass=251.24192
|  Appearance=
|  Density=
|  MeltingPt=
|  BoilingPt=
|  Solubility=
  }}
|Section3= {{Chembox Hazards
|  MainHazards=
|  FlashPt=
|  AutoignitionPt=
  }}
}}
'''Deoxyadenosine''' (symbol '''dA''' or '''dAdo''') is a [[deoxyribonucleoside]]. It is a [[Derivative (chemistry)|derivative]] of the [[nucleoside]] [[adenosine]], differing from the latter by the replacement of a [[hydroxyl]] group (-OH) by hydrogen (-H) at the [[Nucleic acid nomenclature|2′]] position of its [[ribose]] sugar [[moiety (chemistry)|moiety]]. Deoxyadenosine is the DNA nucleoside A, which pairs with [[Thymidine|deoxythymidine]] (T) in double-stranded DNA. 

In absence of [[adenosine deaminase]] (ADA) it accumulates in T lymphocytes and kills these cells resulting in a genetic disorder known as adenosine deaminase severe combined immunodeficiency disease ([[ADA-SCID]]).<ref>{{cite book |last1=Griffiths |first1=Anthony J. F. |last2=Wessler |first2=Susan R. |last3=Carroll |first3=Sean B. |last4=Doebly |first4=John |year=2012 |title=Introduction to Genetic Analysis |edition=10th |publication-place=New York |publisher=W . H. Freeman and Company |isbn=978-1-4641-0661-3}}</ref>

==See also==
*[[Deoxyribonucleotide]]
*[[Cordycepin]] (3′-deoxyadenosine)
*[[Severe combined immunodeficiency]]

==References==
{{Refimprove|date =January 2013}}
<references/>


{{Nucleobases, nucleosides, and nucleotides}}

[[Category:Nucleosides]]
[[Category:Purines]]
[[Category:Hydroxymethyl compounds]]


{{Cell-biology-stub}}