Editing NBQX

{{chembox
| verifiedrevid = 408765621
| ImageFile=NBQX.svg
| ImageSize=
| ImageFile1 = NBQX molecule spacefill.png
| ImageSize1 = 220
| ImageAlt1 = Space-filling model of the NBQX molecule
| PIN=6-Nitro-2,3-dioxo-1,2,3,4-tetrahydrobenzo[''f'']quinoxaline-7-sulfonamide
| OtherNames=
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 4264
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2521927
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C13667
| InChI = 1/C12H8N4O6S/c13-23(21,22)8-3-1-2-5-9(8)7(16(19)20)4-6-10(5)15-12(18)11(17)14-6/h1-4H,(H,14,17)(H,15,18)(H2,13,21,22)
| InChIKey = UQNAFPHGVPVTAL-UHFFFAOYAI
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 222519
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H8N4O6S/c13-23(21,22)8-3-1-2-5-9(8)7(16(19)20)4-6-10(5)15-12(18)11(17)14-6/h1-4H,(H,14,17)(H,15,18)(H2,13,21,22)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UQNAFPHGVPVTAL-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 118876-58-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8LZ6Q43V2S
| PubChem=3272524
| SMILES = [O-][N+](=O)c2cc3c(c1cccc(c12)S(=O)(=O)N)NC(=O)C(=O)N3
}}
|Section2={{Chembox Properties
| Formula=C<sub>12</sub>H<sub>8</sub>N<sub>4</sub>O<sub>6</sub>S
| MolarMass=336.281
| Appearance=brown/red powder
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=Soluble to 100 mM in DMSO
  }}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}

'''NBQX''' (2,3-dioxo-6-nitro-7-sulfamoyl-benzo[f]quinoxaline) is an [[Receptor antagonist|antagonist]] of the [[AMPA receptor]].

NBQX blocks AMPA receptors in micromolar concentrations (~10–20 μM) and also blocks [[kainate receptor]]s. In experiments, it is used to counter [[glutamate]] [[excitotoxicity]].<ref>Pitt, D.; Werner, P.; Raine, C. S. (2000). "Glutamate excitotoxicity in a model of multiple sclerosis". ''Nat Med.'' '''6''' (1): 67–70.</ref> NBQX was found to have anticonvulsant activity in rodent seizure models.<ref>Yamaguchi, S.; Donevan, S.D.; Rogawski, M.A. (1993). Anticonvulsant activity of AMPA/kainate antagonists: comparison of GYKI 52466 and NBOX in maximal electroshock and chemoconvulsant seizure models. ''Epilepsy Res.'' '''15''':179–184.</ref>

As the disodium salt, NBQX is soluble in water at high concentrations (at least up to 100 mM).

==See also==
*[[CNQX]]
*[[DNQX]]
*[[Fanapanel]] (MPQX)
*[[Quinoxalinedione]]

==References==
{{Reflist}}

{{Ionotropic glutamate receptor modulators}}
{{Glycine receptor modulators}}

[[Category:AMPA receptor antagonists]]
[[Category:Kainate receptor antagonists]]
[[Category:Glycine receptor antagonists]]
[[Category:Sulfonamides]]
[[Category:Nitronaphthalenes]]
[[Category:Quinoxalines]]
[[Category:Lactams]]
[[Category:Quinones]]
[[Category:Nitrogen heterocycles]]
[[Category:Heterocyclic compounds with 3 rings]]


{{biochem-stub}}