Editing Triprolidine

{{Short description|Antihistamine medication}}
{{cs1 config|name-list-style=vanc}}
{{About|the drug|the Roman province|Tripolitania|the city|Tripoli (disambiguation){{!}}Tripoli}}
{{drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470617213
| IUPAC_name = 2-[(''E'')-1-(4-methylphenyl)-3-pyrrolidin-1-yl-<br />prop-1-enyl]pyridine
| image = Triprolidine Structural Formula V1.svg
| image_class = skin-invert-image
| tradename = Flonase Nighttime Allergy Relief, Actidil, others
<!--Clinical data-->| Drugs.com = {{drugs.com|monograph|triprolidine-hydrochloride}}
| pregnancy_category = C (US)
| legal_US = otc
| routes_of_administration = [[By mouth]]
<!--Pharmacokinetic data-->| bioavailability = Oral: 4%
| protein_bound = 90%
| metabolism = [[Hepatic]] ([[CYP2D6]])
| elimination_half-life = 4–6 hours
| excretion = [[Renal]]
<!--Identifiers-->| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 486-12-4
| ATC_prefix = R06
| ATC_suffix = AX07
| PubChem = 5282443
| IUPHAR_ligand = 1228
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00427
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445597
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2L8T9S52QM
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D01782
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 84116
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 855
<!--Chemical data-->| C = 19
| H = 22
| N = 2
| SMILES = n3c(\C(=C\CN1CCCC1)c2ccc(cc2)C)cccc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CBEQULMOCCWAQT-WOJGMQOQSA-N
| melting_point = 60
| solubility = 500
}}
<!-- Definition and medical uses -->
'''Triprolidine''' is an [[Over-the-counter drug|over-the-counter]] [[antihistamine]] with [[anticholinergic]] properties.<ref name="Goldsmith">{{cite journal | vauthors = Goldsmith P, Dowd PM | title = The new H1 antihistamines. Treatment of urticaria and other clinical problems | journal = Dermatologic Clinics | volume = 11 | issue = 1 | pages = 87–95 | date = January 1993 | doi = 10.1016/S0733-8635(18)30285-7 | pmid = 8094649 }}</ref> It is used to combat the symptoms associated with [[allergy|allergies]] and is sometimes combined with other [[common cold|cold]] medications designed to provide general relief for [[influenza|flu]]-like symptoms.<ref>{{cite journal | vauthors = Williams BO, Liao SH, Lai AA, Arnold JD, Perkins JG, Blum MR, Findlay JW | title = Bioavailability of pseudoephedrine and triprolidine from combination and single-ingredient products | journal = Clinical Pharmacy | volume = 3 | issue = 6 | pages = 638–43 | year = 1984 | pmid = 6509877 }}</ref> As with many antihistamines, the most common [[Adverse effect (medicine)|side effect]] is drowsiness.<ref name="Goldsmith" />

Today, triprolidine is used less frequently and has been replaced in popular medications by other antihistamines like [[diphenhydramine]], [[promethazine]], [[chlorpheniramine]], as well as [[Second generation antihistamines|second-generation antihistamines]] like [[loratadine]] and [[fexofenadine]]. Triprolidine remains an ingredient in the cold medicine [[Actifed]] in many territories.{{Citation needed|date=March 2025}} 

<!-- Society and culture -->
It was patented in 1948 and came into medical use in 1953.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title= Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=546 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA546 |language=en}}</ref>

== See also ==
*[[Benzatropine]]
*[[Pseudoephedrine]]

== References ==
{{Reflist}}

{{Antihistamines}}
{{Hallucinogens}}
{{Histamine receptor modulators}}
{{Muscarinic acetylcholine receptor modulators}}

[[Category:Alkene derivatives]]
[[Category:H1 receptor antagonists]]
[[Category:Muscarinic antagonists]]
[[Category:2-Pyridyl compounds]]
[[Category:1-Pyrrolidinyl compounds]]
[[Category:4-Tolyl compounds]]