Editing 3C-E (section)

{{Short description|Psychedelic drug}}
{{one source|date=July 2019}}
{{Drugbox
| IUPAC_name = 1-(4-Ethoxy-3,5-dimethoxyphenyl)propan-2-amine
| image = 3C-E.svg

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_CA = Schedule I
| legal_DE = NpSG
| legal_UK = Class B
| legal_US = Analogue of a Schedule I drug, possibly illegal under the Federal Analog Act
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 146849-92-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W9QX56V5RU
| PubChem = 44350137
| ChemSpiderID = 21106237
| ChEMBL = 128038

<!--Chemical data-->
| C=13 | H=21 | N=1 | O=3
| molecular_weight = 
| smiles = CCOc1c(cc(cc1OC)CC(C)N)OC
| StdInChI = 1S/C13H21NO3/c1-5-17-13-11(15-3)7-10(6-9(2)14)8-12(13)16-4/h7-9H,5-6,14H2,1-4H3
| StdInChIKey = AHLXCGRWNKUNTQ-UHFFFAOYSA-N
}}

'''3C-E''' ('''3,5-Dimethoxy-4-ethoxyamphetamine''') is a [[psychedelic drug|psychedelic]] of the [[substituted amphetamine|amphetamine]] class. It was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', Shulgin lists the dosage range as 30 to 60&nbsp;mg, consumed orally.<ref name="PiHKAL">[https://www.erowid.org/library/books_online/pihkal/pihkal025.shtml PiHKAL entry]</ref><ref name="HalberstadtChathaKlein2020">{{cite journal | vauthors = Halberstadt AL, Chatha M, Klein AK, Wallach J, Brandt SD | title = Correlation between the potency of hallucinogens in the mouse head-twitch response assay and their behavioral and subjective effects in other species | journal = Neuropharmacology | volume = 167 | issue = | pages = 107933 | date = May 2020 | pmid = 31917152 | pmc = 9191653 | doi = 10.1016/j.neuropharm.2019.107933 | url = http://usdbiology.com/cliff/Courses/Advanced%20Seminars%20in%20Neuroendocrinology/Serotonergic%20Psychedelics%2020/Halberstadt%2020%20Neuropharm%20potency%20of%20hallucinogens%20%20head-twitch.pdf | quote = Table 4 Human potency data for selected hallucinogens. [...] }}</ref> The duration of action was stated to be 8–12 hours.<ref name=PiHKAL/>

This compound is the amphetamine [[structural analog|analog]] of [[escaline]].